C38H46O2 — CID 72731073
4-[3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]benzoic acid (PubChem CID 72731073) has the molecular formula C38H46O2 and a molecular weight of 534.78 g/mol. Its IUPAC name is 4-[3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]benzoic acid.
| Compound Name | 4-[3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]benzoic acid |
|---|---|
| PubChem CID | 72731073 |
| Molecular Formula | C38H46O2 |
| Molecular Weight | 534.78 g/mol |
| Exact Mass | 534.35 |
| IUPAC Name | 4-[3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]benzoic acid |
| SMILES | CC(C=CC=C(C)C=CC1=C(C)CCCC1(C)C)=CC=CC=C(C)C=CC=C(C)C=Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C38H46O2/c1-29(15-10-17-31(3)20-22-34-23-25-35(26-24-34)37(39)40)13-8-9-14-30(2)16-11-18-32(4)21-27-36-33(5)19-12-28-38(36,6)7/h8-11,13-18,20-27H,12,19,28H2,1-7H3,(H,39,40) |
| InChIKey | FKLMPYOGGHTOBX-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.78 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|