C21H23F3O — CID 44591341
(1E,4E)-1-[4-(trifluoromethyl)phenyl]-5-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-one (PubChem CID 44591341) has the molecular formula C21H23F3O and a molecular weight of 348.41 g/mol. Its IUPAC name is (1E,4E)-1-[4-(trifluoromethyl)phenyl]-5-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-[4-(trifluoromethyl)phenyl]-5-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 44591341 |
| Molecular Formula | C21H23F3O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (1E,4E)-1-[4-(trifluoromethyl)phenyl]-5-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-one |
| SMILES | CC1=C(/C=C/C(=O)/C=C/c2ccc(C(F)(F)F)cc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C21H23F3O/c1-15-5-4-14-20(2,3)19(15)13-12-18(25)11-8-16-6-9-17(10-7-16)21(22,23)24/h6-13H,4-5,14H2,1-3H3/b11-8+,13-12+ |
| InChIKey | DDLANIUXWLHYTO-OWKCIBLPSA-N |
| XLogP | 6.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|