C21H23NO7 — CID 101458472
3-(3,4-dimethoxyphenyl)prop-2-ynyl N-(3,4,5-trimethoxyphenyl)carbamate (PubChem CID 101458472) has the molecular formula C21H23NO7 and a molecular weight of 401.42 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)prop-2-ynyl N-(3,4,5-trimethoxyphenyl)carbamate.
| Compound Name | 3-(3,4-dimethoxyphenyl)prop-2-ynyl N-(3,4,5-trimethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 101458472 |
| Molecular Formula | C21H23NO7 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)prop-2-ynyl N-(3,4,5-trimethoxyphenyl)carbamate |
| SMILES | COc1ccc(C#CCOC(=O)Nc2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C21H23NO7/c1-24-16-9-8-14(11-17(16)25-2)7-6-10-29-21(23)22-15-12-18(26-3)20(28-5)19(13-15)27-4/h8-9,11-13H,10H2,1-5H3,(H,22,23) |
| InChIKey | SXLPJJUOWLBZJW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|