C13H15NO4 — CID 54966436
methyl N-[5-(4-hydroxybut-1-ynyl)-2-methoxyphenyl]carbamate (PubChem CID 54966436) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is methyl N-[5-(4-hydroxybut-1-ynyl)-2-methoxyphenyl]carbamate.
| Compound Name | methyl N-[5-(4-hydroxybut-1-ynyl)-2-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 54966436 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | methyl N-[5-(4-hydroxybut-1-ynyl)-2-methoxyphenyl]carbamate |
| SMILES | COC(=O)Nc1cc(C#CCCO)ccc1OC |
| InChI | InChI=1S/C13H15NO4/c1-17-12-7-6-10(5-3-4-8-15)9-11(12)14-13(16)18-2/h6-7,9,15H,4,8H2,1-2H3,(H,14,16) |
| InChIKey | SKGOYVHAIRKDRR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|