C17H23NO3 — CID 103021843
N-[5-(4-hydroxybut-1-ynyl)-2-methylphenyl]-3-methoxy-3-methylbutanamide (PubChem CID 103021843) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[5-(4-hydroxybut-1-ynyl)-2-methylphenyl]-3-methoxy-3-methylbutanamide.
| Compound Name | N-[5-(4-hydroxybut-1-ynyl)-2-methylphenyl]-3-methoxy-3-methylbutanamide |
|---|---|
| PubChem CID | 103021843 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-[5-(4-hydroxybut-1-ynyl)-2-methylphenyl]-3-methoxy-3-methylbutanamide |
| SMILES | COC(C)(C)CC(=O)Nc1cc(C#CCCO)ccc1C |
| InChI | InChI=1S/C17H23NO3/c1-13-8-9-14(7-5-6-10-19)11-15(13)18-16(20)12-17(2,3)21-4/h8-9,11,19H,6,10,12H2,1-4H3,(H,18,20) |
| InChIKey | VVQNPQSRFXGXNG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|