C11H10ClNO3 — CID 62915792
methyl N-[2-chloro-5-(3-hydroxyprop-1-ynyl)phenyl]carbamate (PubChem CID 62915792) has the molecular formula C11H10ClNO3 and a molecular weight of 239.66 g/mol. Its IUPAC name is methyl N-[2-chloro-5-(3-hydroxyprop-1-ynyl)phenyl]carbamate.
| Compound Name | methyl N-[2-chloro-5-(3-hydroxyprop-1-ynyl)phenyl]carbamate |
|---|---|
| PubChem CID | 62915792 |
| Molecular Formula | C11H10ClNO3 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | methyl N-[2-chloro-5-(3-hydroxyprop-1-ynyl)phenyl]carbamate |
| SMILES | COC(=O)Nc1cc(C#CCO)ccc1Cl |
| InChI | InChI=1S/C11H10ClNO3/c1-16-11(15)13-10-7-8(3-2-6-14)4-5-9(10)12/h4-5,7,14H,6H2,1H3,(H,13,15) |
| InChIKey | JEBRKOSYUJSKQW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|