C14H11ClN2O3 — CID 62915057
N-[2-chloro-5-(3-hydroxyprop-1-ynyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide (PubChem CID 62915057) has the molecular formula C14H11ClN2O3 and a molecular weight of 290.71 g/mol. Its IUPAC name is N-[2-chloro-5-(3-hydroxyprop-1-ynyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-[2-chloro-5-(3-hydroxyprop-1-ynyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 62915057 |
| Molecular Formula | C14H11ClN2O3 |
| Molecular Weight | 290.71 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | N-[2-chloro-5-(3-hydroxyprop-1-ynyl)phenyl]-3-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cc(C#CCO)ccc2Cl)on1 |
| InChI | InChI=1S/C14H11ClN2O3/c1-9-7-13(20-17-9)14(19)16-12-8-10(3-2-6-18)4-5-11(12)15/h4-5,7-8,18H,6H2,1H3,(H,16,19) |
| InChIKey | BIEFGOHWPANZCQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.71 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|