C13H10ClN3O2 — CID 63080337
N-[2-chloro-5-(3-hydroxyprop-1-ynyl)phenyl]-1H-pyrazole-5-carboxamide (PubChem CID 63080337) has the molecular formula C13H10ClN3O2 and a molecular weight of 275.70 g/mol. Its IUPAC name is N-[2-chloro-5-(3-hydroxyprop-1-ynyl)phenyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[2-chloro-5-(3-hydroxyprop-1-ynyl)phenyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 63080337 |
| Molecular Formula | C13H10ClN3O2 |
| Molecular Weight | 275.70 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | N-[2-chloro-5-(3-hydroxyprop-1-ynyl)phenyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1cc(C#CCO)ccc1Cl)c1ccn[nH]1 |
| InChI | InChI=1S/C13H10ClN3O2/c14-10-4-3-9(2-1-7-18)8-12(10)16-13(19)11-5-6-15-17-11/h3-6,8,18H,7H2,(H,15,17)(H,16,19) |
| InChIKey | LQFGRWAQRXDSCU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.70 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|