C20H21N3O5 — CID 90553402
4-[3-[(3,4,5-trimethoxyphenyl)carbamoylamino]prop-1-ynyl]benzamide (PubChem CID 90553402) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 4-[3-[(3,4,5-trimethoxyphenyl)carbamoylamino]prop-1-ynyl]benzamide.
| Compound Name | 4-[3-[(3,4,5-trimethoxyphenyl)carbamoylamino]prop-1-ynyl]benzamide |
|---|---|
| PubChem CID | 90553402 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-[3-[(3,4,5-trimethoxyphenyl)carbamoylamino]prop-1-ynyl]benzamide |
| SMILES | COc1cc(NC(=O)NCC#Cc2ccc(C(N)=O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H21N3O5/c1-26-16-11-15(12-17(27-2)18(16)28-3)23-20(25)22-10-4-5-13-6-8-14(9-7-13)19(21)24/h6-9,11-12H,10H2,1-3H3,(H2,21,24)(H2,22,23,25) |
| InChIKey | UZHUCGVALXSQDZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|