C19H19N3O4 — CID 90553408
4-[3-[(2,3-dimethoxyphenyl)carbamoylamino]prop-1-ynyl]benzamide (PubChem CID 90553408) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is 4-[3-[(2,3-dimethoxyphenyl)carbamoylamino]prop-1-ynyl]benzamide.
| Compound Name | 4-[3-[(2,3-dimethoxyphenyl)carbamoylamino]prop-1-ynyl]benzamide |
|---|---|
| PubChem CID | 90553408 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 4-[3-[(2,3-dimethoxyphenyl)carbamoylamino]prop-1-ynyl]benzamide |
| SMILES | COc1cccc(NC(=O)NCC#Cc2ccc(C(N)=O)cc2)c1OC |
| InChI | InChI=1S/C19H19N3O4/c1-25-16-7-3-6-15(17(16)26-2)22-19(24)21-12-4-5-13-8-10-14(11-9-13)18(20)23/h3,6-11H,12H2,1-2H3,(H2,20,23)(H2,21,22,24) |
| InChIKey | ZLVZQNLXWUEEEY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|