C20H22N2O4 — CID 90575382
1-(2,3-dimethoxyphenyl)-3-[4-(2-methylphenoxy)but-2-ynyl]urea (PubChem CID 90575382) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-(2,3-dimethoxyphenyl)-3-[4-(2-methylphenoxy)but-2-ynyl]urea.
| Compound Name | 1-(2,3-dimethoxyphenyl)-3-[4-(2-methylphenoxy)but-2-ynyl]urea |
|---|---|
| PubChem CID | 90575382 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-(2,3-dimethoxyphenyl)-3-[4-(2-methylphenoxy)but-2-ynyl]urea |
| SMILES | COc1cccc(NC(=O)NCC#CCOc2ccccc2C)c1OC |
| InChI | InChI=1S/C20H22N2O4/c1-15-9-4-5-11-17(15)26-14-7-6-13-21-20(23)22-16-10-8-12-18(24-2)19(16)25-3/h4-5,8-12H,13-14H2,1-3H3,(H2,21,22,23) |
| InChIKey | BIOPWAIERJEEHH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|