C22H18N2O2 — CID 90549825
4-[3-[(2-naphthalen-1-ylacetyl)amino]prop-1-ynyl]benzamide (PubChem CID 90549825) has the molecular formula C22H18N2O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 4-[3-[(2-naphthalen-1-ylacetyl)amino]prop-1-ynyl]benzamide.
| Compound Name | 4-[3-[(2-naphthalen-1-ylacetyl)amino]prop-1-ynyl]benzamide |
|---|---|
| PubChem CID | 90549825 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 4-[3-[(2-naphthalen-1-ylacetyl)amino]prop-1-ynyl]benzamide |
| SMILES | NC(=O)c1ccc(C#CCNC(=O)Cc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H18N2O2/c23-22(26)18-12-10-16(11-13-18)5-4-14-24-21(25)15-19-8-3-7-17-6-1-2-9-20(17)19/h1-3,6-13H,14-15H2,(H2,23,26)(H,24,25) |
| InChIKey | DBWNOARLHXFXMP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|