C14H15ClN2O2 — CID 90549739
4-[3-(4-chlorobutanoylamino)prop-1-ynyl]benzamide (PubChem CID 90549739) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is 4-[3-(4-chlorobutanoylamino)prop-1-ynyl]benzamide.
| Compound Name | 4-[3-(4-chlorobutanoylamino)prop-1-ynyl]benzamide |
|---|---|
| PubChem CID | 90549739 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 4-[3-(4-chlorobutanoylamino)prop-1-ynyl]benzamide |
| SMILES | NC(=O)c1ccc(C#CCNC(=O)CCCCl)cc1 |
| InChI | InChI=1S/C14H15ClN2O2/c15-9-1-4-13(18)17-10-2-3-11-5-7-12(8-6-11)14(16)19/h5-8H,1,4,9-10H2,(H2,16,19)(H,17,18) |
| InChIKey | QZYUZWALNFMRSV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|