C12H17NO6 — CID 79346534
2-hydroxyethyl N-[3-(2-hydroxyethoxy)-4-methoxyphenyl]carbamate (PubChem CID 79346534) has the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. Its IUPAC name is 2-hydroxyethyl N-[3-(2-hydroxyethoxy)-4-methoxyphenyl]carbamate.
| Compound Name | 2-hydroxyethyl N-[3-(2-hydroxyethoxy)-4-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 79346534 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2-hydroxyethyl N-[3-(2-hydroxyethoxy)-4-methoxyphenyl]carbamate |
| SMILES | COc1ccc(NC(=O)OCCO)cc1OCCO |
| InChI | InChI=1S/C12H17NO6/c1-17-10-3-2-9(8-11(10)18-6-4-14)13-12(16)19-7-5-15/h2-3,8,14-15H,4-7H2,1H3,(H,13,16) |
| InChIKey | NLCDTTLPBUMNKB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |