C12H15NO6 — CID 55049598
3-[3-(2-hydroxyethoxy)-4-methoxyanilino]-3-oxopropanoic acid (PubChem CID 55049598) has the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. Its IUPAC name is 3-[3-(2-hydroxyethoxy)-4-methoxyanilino]-3-oxopropanoic acid.
| Compound Name | 3-[3-(2-hydroxyethoxy)-4-methoxyanilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 55049598 |
| Molecular Formula | C12H15NO6 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 3-[3-(2-hydroxyethoxy)-4-methoxyanilino]-3-oxopropanoic acid |
| SMILES | COc1ccc(NC(=O)CC(=O)O)cc1OCCO |
| InChI | InChI=1S/C12H15NO6/c1-18-9-3-2-8(6-10(9)19-5-4-14)13-11(15)7-12(16)17/h2-3,6,14H,4-5,7H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | OZXUXXPFWGAWPT-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|