C12H17NO5 — CID 66173740
2-[3-(2-hydroxyethoxy)-4-methoxyanilino]propanoic acid (PubChem CID 66173740) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 2-[3-(2-hydroxyethoxy)-4-methoxyanilino]propanoic acid.
| Compound Name | 2-[3-(2-hydroxyethoxy)-4-methoxyanilino]propanoic acid |
|---|---|
| PubChem CID | 66173740 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-[3-(2-hydroxyethoxy)-4-methoxyanilino]propanoic acid |
| SMILES | COc1ccc(NC(C)C(=O)O)cc1OCCO |
| InChI | InChI=1S/C12H17NO5/c1-8(12(15)16)13-9-3-4-10(17-2)11(7-9)18-6-5-14/h3-4,7-8,13-14H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | IBNBPMUVUZGNMB-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|