C20H20O4 — CID 11587853
1,2,3-trimethoxy-5-[(Z)-4-(4-methoxyphenyl)but-1-en-3-ynyl]benzene (PubChem CID 11587853) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1,2,3-trimethoxy-5-[(Z)-4-(4-methoxyphenyl)but-1-en-3-ynyl]benzene.
| Compound Name | 1,2,3-trimethoxy-5-[(Z)-4-(4-methoxyphenyl)but-1-en-3-ynyl]benzene |
|---|---|
| PubChem CID | 11587853 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 1,2,3-trimethoxy-5-[(Z)-4-(4-methoxyphenyl)but-1-en-3-ynyl]benzene |
| SMILES | COc1ccc(C#C/C=C\c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H20O4/c1-21-17-11-9-15(10-12-17)7-5-6-8-16-13-18(22-2)20(24-4)19(14-16)23-3/h6,8-14H,1-4H3/b8-6- |
| InChIKey | XJZOTAPRBYORRG-VURMDHGXSA-N |
| XLogP | 3.79 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|