C21H26O4 — CID 86208123
5-[2-(4-butoxyphenyl)ethenyl]-1,2,3-trimethoxybenzene (PubChem CID 86208123) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is 5-[2-(4-butoxyphenyl)ethenyl]-1,2,3-trimethoxybenzene.
| Compound Name | 5-[2-(4-butoxyphenyl)ethenyl]-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 86208123 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 5-[2-(4-butoxyphenyl)ethenyl]-1,2,3-trimethoxybenzene |
| SMILES | CCCCOc1ccc(C=Cc2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H26O4/c1-5-6-13-25-18-11-9-16(10-12-18)7-8-17-14-19(22-2)21(24-4)20(15-17)23-3/h7-12,14-15H,5-6,13H2,1-4H3 |
| InChIKey | DTZKENQMRXFQEC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|