C18H18F2O4 — CID 137454170
5-[(Z)-2-[4-(difluoromethoxy)phenyl]ethenyl]-1,2,3-trimethoxybenzene (PubChem CID 137454170) has the molecular formula C18H18F2O4 and a molecular weight of 336.33 g/mol. Its IUPAC name is 5-[(Z)-2-[4-(difluoromethoxy)phenyl]ethenyl]-1,2,3-trimethoxybenzene.
| Compound Name | 5-[(Z)-2-[4-(difluoromethoxy)phenyl]ethenyl]-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 137454170 |
| Molecular Formula | C18H18F2O4 |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 5-[(Z)-2-[4-(difluoromethoxy)phenyl]ethenyl]-1,2,3-trimethoxybenzene |
| SMILES | COc1cc(/C=C\c2ccc(OC(F)F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C18H18F2O4/c1-21-15-10-13(11-16(22-2)17(15)23-3)5-4-12-6-8-14(9-7-12)24-18(19)20/h4-11,18H,1-3H3/b5-4- |
| InChIKey | UAABLFUWGRFUEX-PLNGDYQASA-N |
| XLogP | 4.48 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|