C17H18Na2O7P — CID 59087049
CID 59087049 (PubChem CID 59087049) has the molecular formula C17H18Na2O7P and a molecular weight of 411.28 g/mol.
| Compound Name | CID 59087049 |
|---|---|
| PubChem CID | 59087049 |
| Molecular Formula | C17H18Na2O7P |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | — |
| SMILES | COc1cc(/C=C\c2ccc(OP(=O)([O-])O)cc2)cc(OC)c1OC.[Na+].[Na] |
| InChI | InChI=1S/C17H19O7P.2Na/c1-21-15-10-13(11-16(22-2)17(15)23-3)5-4-12-6-8-14(9-7-12)24-25(18,19)20;;/h4-11H,1-3H3,(H2,18,19,20);;/q;;+1/p-1/b5-4-;; |
| InChIKey | HBBKKLFUDVFKAU-WNCVTPEDSA-M |
| XLogP | -0.65 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|