C18H19Na2O9P — CID 53465723
disodium;[2-hydroxy-3-methoxy-6-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate (PubChem CID 53465723) has the molecular formula C18H19Na2O9P and a molecular weight of 456.30 g/mol. Its IUPAC name is disodium;[2-hydroxy-3-methoxy-6-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate.
| Compound Name | disodium;[2-hydroxy-3-methoxy-6-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate |
|---|---|
| PubChem CID | 53465723 |
| Molecular Formula | C18H19Na2O9P |
| Molecular Weight | 456.30 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | disodium;[2-hydroxy-3-methoxy-6-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate |
| SMILES | COc1ccc(/C=C/c2cc(OC)c(OC)c(OC)c2)c(OP(=O)([O-])[O-])c1O.[Na+].[Na+] |
| InChI | InChI=1S/C18H21O9P.2Na/c1-23-13-8-7-12(17(16(13)19)27-28(20,21)22)6-5-11-9-14(24-2)18(26-4)15(10-11)25-3;;/h5-10,19H,1-4H3,(H2,20,21,22);;/q;2*+1/p-2/b6-5+;; |
| InChIKey | NAKVJFXASSPPIY-TXOOBNKBSA-L |
| XLogP | -4.19 |
| TPSA | 129.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.30 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|