C18H19F2O9P — CID 91497115
[2-(difluoromethoxy)-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy] dihydrogen phosphate (PubChem CID 91497115) has the molecular formula C18H19F2O9P and a molecular weight of 448.31 g/mol. Its IUPAC name is [2-(difluoromethoxy)-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy] dihydrogen phosphate.
| Compound Name | [2-(difluoromethoxy)-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy] dihydrogen phosphate |
|---|---|
| PubChem CID | 91497115 |
| Molecular Formula | C18H19F2O9P |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | [2-(difluoromethoxy)-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy] dihydrogen phosphate |
| SMILES | COc1cc(C=Cc2ccc(OC(F)F)c(OOP(=O)(O)O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C18H19F2O9P/c1-24-15-9-12(10-16(25-2)17(15)26-3)5-4-11-6-7-13(27-18(19)20)14(8-11)28-29-30(21,22)23/h4-10,18H,1-3H3,(H2,21,22,23) |
| InChIKey | DZHDQROPJQTRSD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|