C25H17F5N2O4 — CID 4853013
2-(1H-benzimidazol-2-yl)-3-(2,3,4,5,6-pentafluorophenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 4853013) has the molecular formula C25H17F5N2O4 and a molecular weight of 504.41 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-(2,3,4,5,6-pentafluorophenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-(2,3,4,5,6-pentafluorophenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4853013 |
| Molecular Formula | C25H17F5N2O4 |
| Molecular Weight | 504.41 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-(2,3,4,5,6-pentafluorophenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C(=O)C(=Cc2c(F)c(F)c(F)c(F)c2F)c2nc3ccccc3[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C25H17F5N2O4/c1-34-16-8-11(9-17(35-2)24(16)36-3)23(33)13(25-31-14-6-4-5-7-15(14)32-25)10-12-18(26)20(28)22(30)21(29)19(12)27/h4-10H,1-3H3,(H,31,32) |
| InChIKey | OWARJNCZPZARTB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.41 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|