C26H21N3O4 — CID 94364266
4-[(E)-2-(1H-benzimidazol-2-yl)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]benzonitrile (PubChem CID 94364266) has the molecular formula C26H21N3O4 and a molecular weight of 439.47 g/mol. Its IUPAC name is 4-[(E)-2-(1H-benzimidazol-2-yl)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]benzonitrile.
| Compound Name | 4-[(E)-2-(1H-benzimidazol-2-yl)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 94364266 |
| Molecular Formula | C26H21N3O4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 4-[(E)-2-(1H-benzimidazol-2-yl)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]benzonitrile |
| SMILES | COc1cc(C(=O)/C(=C/c2ccc(C#N)cc2)c2nc3ccccc3[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C26H21N3O4/c1-31-22-13-18(14-23(32-2)25(22)33-3)24(30)19(12-16-8-10-17(15-27)11-9-16)26-28-20-6-4-5-7-21(20)29-26/h4-14H,1-3H3,(H,28,29)/b19-12- |
| InChIKey | UOIAPFDYANOZFP-UNOMPAQXSA-N |
| XLogP | 4.88 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|