C24H18N2O3 — CID 4177278
methyl 4-[2-(1H-benzimidazol-2-yl)-3-oxo-3-phenylprop-1-enyl]benzoate (PubChem CID 4177278) has the molecular formula C24H18N2O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is methyl 4-[2-(1H-benzimidazol-2-yl)-3-oxo-3-phenylprop-1-enyl]benzoate.
| Compound Name | methyl 4-[2-(1H-benzimidazol-2-yl)-3-oxo-3-phenylprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 4177278 |
| Molecular Formula | C24H18N2O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | methyl 4-[2-(1H-benzimidazol-2-yl)-3-oxo-3-phenylprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(C=C(C(=O)c2ccccc2)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C24H18N2O3/c1-29-24(28)18-13-11-16(12-14-18)15-19(22(27)17-7-3-2-4-8-17)23-25-20-9-5-6-10-21(20)26-23/h2-15H,1H3,(H,25,26) |
| InChIKey | MOUVAVMBHYPYPW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|