C23H18N2O4S — CID 6224133
methyl 4-[(E)-2-(benzenesulfonyl)-2-(1H-benzimidazol-2-yl)ethenyl]benzoate (PubChem CID 6224133) has the molecular formula C23H18N2O4S and a molecular weight of 418.47 g/mol. Its IUPAC name is methyl 4-[(E)-2-(benzenesulfonyl)-2-(1H-benzimidazol-2-yl)ethenyl]benzoate.
| Compound Name | methyl 4-[(E)-2-(benzenesulfonyl)-2-(1H-benzimidazol-2-yl)ethenyl]benzoate |
|---|---|
| PubChem CID | 6224133 |
| Molecular Formula | C23H18N2O4S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | methyl 4-[(E)-2-(benzenesulfonyl)-2-(1H-benzimidazol-2-yl)ethenyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C(\c2nc3ccccc3[nH]2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H18N2O4S/c1-29-23(26)17-13-11-16(12-14-17)15-21(30(27,28)18-7-3-2-4-8-18)22-24-19-9-5-6-10-20(19)25-22/h2-15H,1H3,(H,24,25)/b21-15+ |
| InChIKey | VGRPIMUPFCVPNI-RCCKNPSSSA-N |
| XLogP | 4.32 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |