C17H14N2O3S — CID 4092252
methyl 4-[(3-oxo-4H-quinoxalin-2-yl)sulfanylmethyl]benzoate (PubChem CID 4092252) has the molecular formula C17H14N2O3S and a molecular weight of 326.38 g/mol. Its IUPAC name is methyl 4-[(3-oxo-4H-quinoxalin-2-yl)sulfanylmethyl]benzoate.
| Compound Name | methyl 4-[(3-oxo-4H-quinoxalin-2-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 4092252 |
| Molecular Formula | C17H14N2O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | methyl 4-[(3-oxo-4H-quinoxalin-2-yl)sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CSc2nc3ccccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C17H14N2O3S/c1-22-17(21)12-8-6-11(7-9-12)10-23-16-15(20)18-13-4-2-3-5-14(13)19-16/h2-9H,10H2,1H3,(H,18,20) |
| InChIKey | YJJMUCMYSLVRRM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |