C16H15N3O4S2 — CID 2369074
methyl 4-[(6-sulfamoyl-1H-benzimidazol-2-yl)sulfanylmethyl]benzoate (PubChem CID 2369074) has the molecular formula C16H15N3O4S2 and a molecular weight of 377.45 g/mol. Its IUPAC name is methyl 4-[(6-sulfamoyl-1H-benzimidazol-2-yl)sulfanylmethyl]benzoate.
| Compound Name | methyl 4-[(6-sulfamoyl-1H-benzimidazol-2-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 2369074 |
| Molecular Formula | C16H15N3O4S2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | methyl 4-[(6-sulfamoyl-1H-benzimidazol-2-yl)sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CSc2nc3ccc(S(N)(=O)=O)cc3[nH]2)cc1 |
| InChI | InChI=1S/C16H15N3O4S2/c1-23-15(20)11-4-2-10(3-5-11)9-24-16-18-13-7-6-12(25(17,21)22)8-14(13)19-16/h2-8H,9H2,1H3,(H,18,19)(H2,17,21,22) |
| InChIKey | VAUANUARCQCTPS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |