C17H16N2O4S — CID 66622080
4-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfanylmethyl]benzoic acid (PubChem CID 66622080) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is 4-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfanylmethyl]benzoic acid.
| Compound Name | 4-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 66622080 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 4-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfanylmethyl]benzoic acid |
| SMILES | COc1cc2nc(SCc3ccc(C(=O)O)cc3)[nH]c2cc1OC |
| InChI | InChI=1S/C17H16N2O4S/c1-22-14-7-12-13(8-15(14)23-2)19-17(18-12)24-9-10-3-5-11(6-4-10)16(20)21/h3-8H,9H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | PQCRDGSWCQOMEH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |