C11H13N3O2S2 — CID 84616845
2-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfanyl]ethanethioamide (PubChem CID 84616845) has the molecular formula C11H13N3O2S2 and a molecular weight of 283.38 g/mol. Its IUPAC name is 2-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfanyl]ethanethioamide.
| Compound Name | 2-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfanyl]ethanethioamide |
|---|---|
| PubChem CID | 84616845 |
| Molecular Formula | C11H13N3O2S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 2-[(5,6-dimethoxy-1H-benzimidazol-2-yl)sulfanyl]ethanethioamide |
| SMILES | COc1cc2nc(SCC(N)=S)[nH]c2cc1OC |
| InChI | InChI=1S/C11H13N3O2S2/c1-15-8-3-6-7(4-9(8)16-2)14-11(13-6)18-5-10(12)17/h3-4H,5H2,1-2H3,(H2,12,17)(H,13,14) |
| InChIKey | QAKDBBMTIOMFSU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|