C13H18N2O2 — CID 39158314
2-tert-butyl-5,6-dimethoxy-1H-benzimidazole (PubChem CID 39158314) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-tert-butyl-5,6-dimethoxy-1H-benzimidazole.
| Compound Name | 2-tert-butyl-5,6-dimethoxy-1H-benzimidazole |
|---|---|
| PubChem CID | 39158314 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-tert-butyl-5,6-dimethoxy-1H-benzimidazole |
| SMILES | COc1cc2nc(C(C)(C)C)[nH]c2cc1OC |
| InChI | InChI=1S/C13H18N2O2/c1-13(2,3)12-14-8-6-10(16-4)11(17-5)7-9(8)15-12/h6-7H,1-5H3,(H,14,15) |
| InChIKey | WDHYMOMQIFPAAU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |