C20H18N4O2S2 — CID 10295050
N-(4-aminothiophen-3-yl)-4-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]benzamide (PubChem CID 10295050) has the molecular formula C20H18N4O2S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-(4-aminothiophen-3-yl)-4-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]benzamide.
| Compound Name | N-(4-aminothiophen-3-yl)-4-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 10295050 |
| Molecular Formula | C20H18N4O2S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N-(4-aminothiophen-3-yl)-4-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]benzamide |
| SMILES | COc1ccc2nc(SCc3ccc(C(=O)Nc4cscc4N)cc3)[nH]c2c1 |
| InChI | InChI=1S/C20H18N4O2S2/c1-26-14-6-7-16-17(8-14)24-20(23-16)28-9-12-2-4-13(5-3-12)19(25)22-18-11-27-10-15(18)21/h2-8,10-11H,9,21H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | FFQHOAVYSDJKCS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |