C25H28N4O2S — CID 143508693
N-(2-aminophenyl)-4-[(6-methoxy-1-methylbenzimidazol-2-yl)sulfanylmethyl]benzamide;ethane (PubChem CID 143508693) has the molecular formula C25H28N4O2S and a molecular weight of 448.59 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[(6-methoxy-1-methylbenzimidazol-2-yl)sulfanylmethyl]benzamide;ethane.
| Compound Name | N-(2-aminophenyl)-4-[(6-methoxy-1-methylbenzimidazol-2-yl)sulfanylmethyl]benzamide;ethane |
|---|---|
| PubChem CID | 143508693 |
| Molecular Formula | C25H28N4O2S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | N-(2-aminophenyl)-4-[(6-methoxy-1-methylbenzimidazol-2-yl)sulfanylmethyl]benzamide;ethane |
| SMILES | CC.COc1ccc2nc(SCc3ccc(C(=O)Nc4ccccc4N)cc3)n(C)c2c1 |
| InChI | InChI=1S/C23H22N4O2S.C2H6/c1-27-21-13-17(29-2)11-12-20(21)26-23(27)30-14-15-7-9-16(10-8-15)22(28)25-19-6-4-3-5-18(19)24;1-2/h3-13H,14,24H2,1-2H3,(H,25,28);1-2H3 |
| InChIKey | KNDNNQMZNROBTM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|