C23H22N4O3S — CID 58926774
N-(2-aminophenyl)-4-[(6-methoxy-1-methylbenzimidazol-2-yl)sulfinylmethyl]benzamide (PubChem CID 58926774) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[(6-methoxy-1-methylbenzimidazol-2-yl)sulfinylmethyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[(6-methoxy-1-methylbenzimidazol-2-yl)sulfinylmethyl]benzamide |
|---|---|
| PubChem CID | 58926774 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | N-(2-aminophenyl)-4-[(6-methoxy-1-methylbenzimidazol-2-yl)sulfinylmethyl]benzamide |
| SMILES | COc1ccc2nc(S(=O)Cc3ccc(C(=O)Nc4ccccc4N)cc3)n(C)c2c1 |
| InChI | InChI=1S/C23H22N4O3S/c1-27-21-13-17(30-2)11-12-20(21)26-23(27)31(29)14-15-7-9-16(10-8-15)22(28)25-19-6-4-3-5-18(19)24/h3-13H,14,24H2,1-2H3,(H,25,28) |
| InChIKey | GQHJCSCZQRMUNU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|