C19H20FN3OS — CID 22522475
2-[(4-fluorophenyl)methylsulfanyl]-3-methyl-N-propylbenzimidazole-5-carboxamide (PubChem CID 22522475) has the molecular formula C19H20FN3OS and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylsulfanyl]-3-methyl-N-propylbenzimidazole-5-carboxamide.
| Compound Name | 2-[(4-fluorophenyl)methylsulfanyl]-3-methyl-N-propylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 22522475 |
| Molecular Formula | C19H20FN3OS |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-[(4-fluorophenyl)methylsulfanyl]-3-methyl-N-propylbenzimidazole-5-carboxamide |
| SMILES | CCCNC(=O)c1ccc2nc(SCc3ccc(F)cc3)n(C)c2c1 |
| InChI | InChI=1S/C19H20FN3OS/c1-3-10-21-18(24)14-6-9-16-17(11-14)23(2)19(22-16)25-12-13-4-7-15(20)8-5-13/h4-9,11H,3,10,12H2,1-2H3,(H,21,24) |
| InChIKey | ZXTMUMXOIWFHLZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |