C29H29FN4OS — CID 20887226
N-[2-(cyclohexen-1-yl)ethyl]-4-[[2-[(4-fluorophenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]methyl]benzamide (PubChem CID 20887226) has the molecular formula C29H29FN4OS and a molecular weight of 500.64 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-4-[[2-[(4-fluorophenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]methyl]benzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-4-[[2-[(4-fluorophenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 20887226 |
| Molecular Formula | C29H29FN4OS |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-4-[[2-[(4-fluorophenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]methyl]benzamide |
| SMILES | O=C(NCCC1=CCCCC1)c1ccc(Cn2c(SCc3ccc(F)cc3)nc3ccncc32)cc1 |
| InChI | InChI=1S/C29H29FN4OS/c30-25-12-8-23(9-13-25)20-36-29-33-26-15-16-31-18-27(26)34(29)19-22-6-10-24(11-7-22)28(35)32-17-14-21-4-2-1-3-5-21/h4,6-13,15-16,18H,1-3,5,14,17,19-20H2,(H,32,35) |
| InChIKey | FOIWFVPTVGVWPV-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|