C24H22ClFN4O2S — CID 50764056
4-[[2-[(2-chloro-4-fluorophenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]methyl]-N-(2-methoxyethyl)benzamide (PubChem CID 50764056) has the molecular formula C24H22ClFN4O2S and a molecular weight of 484.98 g/mol. Its IUPAC name is 4-[[2-[(2-chloro-4-fluorophenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]methyl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-[[2-[(2-chloro-4-fluorophenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]methyl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 50764056 |
| Molecular Formula | C24H22ClFN4O2S |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 4-[[2-[(2-chloro-4-fluorophenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]methyl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(Cn2c(SCc3ccc(F)cc3Cl)nc3ccncc32)cc1 |
| InChI | InChI=1S/C24H22ClFN4O2S/c1-32-11-10-28-23(31)17-4-2-16(3-5-17)14-30-22-13-27-9-8-21(22)29-24(30)33-15-18-6-7-19(26)12-20(18)25/h2-9,12-13H,10-11,14-15H2,1H3,(H,28,31) |
| InChIKey | WRJVOEUBJYUQKP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|