C27H30N4O3S — CID 46288293
N-(3-ethoxypropyl)-4-[[2-[(4-methoxyphenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]methyl]benzamide (PubChem CID 46288293) has the molecular formula C27H30N4O3S and a molecular weight of 490.63 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-4-[[2-[(4-methoxyphenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]methyl]benzamide.
| Compound Name | N-(3-ethoxypropyl)-4-[[2-[(4-methoxyphenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 46288293 |
| Molecular Formula | C27H30N4O3S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | N-(3-ethoxypropyl)-4-[[2-[(4-methoxyphenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]methyl]benzamide |
| SMILES | CCOCCCNC(=O)c1ccc(Cn2c(SCc3ccc(OC)cc3)nc3ccncc32)cc1 |
| InChI | InChI=1S/C27H30N4O3S/c1-3-34-16-4-14-29-26(32)22-9-5-20(6-10-22)18-31-25-17-28-15-13-24(25)30-27(31)35-19-21-7-11-23(33-2)12-8-21/h5-13,15,17H,3-4,14,16,18-19H2,1-2H3,(H,29,32) |
| InChIKey | PUPOTVCDVJBJIN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|