C26H27ClN4O2S — CID 50764041
4-[[2-[(4-chlorophenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]methyl]-N-(3-ethoxypropyl)benzamide (PubChem CID 50764041) has the molecular formula C26H27ClN4O2S and a molecular weight of 495.05 g/mol. Its IUPAC name is 4-[[2-[(4-chlorophenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]methyl]-N-(3-ethoxypropyl)benzamide.
| Compound Name | 4-[[2-[(4-chlorophenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]methyl]-N-(3-ethoxypropyl)benzamide |
|---|---|
| PubChem CID | 50764041 |
| Molecular Formula | C26H27ClN4O2S |
| Molecular Weight | 495.05 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 4-[[2-[(4-chlorophenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]methyl]-N-(3-ethoxypropyl)benzamide |
| SMILES | CCOCCCNC(=O)c1ccc(Cn2c(SCc3ccc(Cl)cc3)nc3ccncc32)cc1 |
| InChI | InChI=1S/C26H27ClN4O2S/c1-2-33-15-3-13-29-25(32)21-8-4-19(5-9-21)17-31-24-16-28-14-12-23(24)30-26(31)34-18-20-6-10-22(27)11-7-20/h4-12,14,16H,2-3,13,15,17-18H2,1H3,(H,29,32) |
| InChIKey | CAGYWAONRYNDIP-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.05 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|