C25H24ClFN4OS — CID 46288313
N-butyl-4-[[2-[(2-chloro-4-fluorophenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]methyl]benzamide (PubChem CID 46288313) has the molecular formula C25H24ClFN4OS and a molecular weight of 483.01 g/mol. Its IUPAC name is N-butyl-4-[[2-[(2-chloro-4-fluorophenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]methyl]benzamide.
| Compound Name | N-butyl-4-[[2-[(2-chloro-4-fluorophenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 46288313 |
| Molecular Formula | C25H24ClFN4OS |
| Molecular Weight | 483.01 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | N-butyl-4-[[2-[(2-chloro-4-fluorophenyl)methylsulfanyl]imidazo[4,5-c]pyridin-3-yl]methyl]benzamide |
| SMILES | CCCCNC(=O)c1ccc(Cn2c(SCc3ccc(F)cc3Cl)nc3ccncc32)cc1 |
| InChI | InChI=1S/C25H24ClFN4OS/c1-2-3-11-29-24(32)18-6-4-17(5-7-18)15-31-23-14-28-12-10-22(23)30-25(31)33-16-19-8-9-20(27)13-21(19)26/h4-10,12-14H,2-3,11,15-16H2,1H3,(H,29,32) |
| InChIKey | JWDHVUBJCDZLIG-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.01 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|