C21H17N3O3S — CID 19098794
[4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)-2-methoxyphenyl] benzoate (PubChem CID 19098794) has the molecular formula C21H17N3O3S and a molecular weight of 391.45 g/mol. Its IUPAC name is [4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)-2-methoxyphenyl] benzoate.
| Compound Name | [4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)-2-methoxyphenyl] benzoate |
|---|---|
| PubChem CID | 19098794 |
| Molecular Formula | C21H17N3O3S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | [4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)-2-methoxyphenyl] benzoate |
| SMILES | COc1cc(CSc2nc3ccncc3[nH]2)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H17N3O3S/c1-26-19-11-14(13-28-21-23-16-9-10-22-12-17(16)24-21)7-8-18(19)27-20(25)15-5-3-2-4-6-15/h2-12H,13H2,1H3,(H,23,24) |
| InChIKey | JQLOHIZYKURMHO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|