C15H15N3O2S — CID 15037656
2-[(3,5-dimethoxyphenyl)methylsulfanyl]-3H-imidazo[4,5-c]pyridine (PubChem CID 15037656) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-[(3,5-dimethoxyphenyl)methylsulfanyl]-3H-imidazo[4,5-c]pyridine.
| Compound Name | 2-[(3,5-dimethoxyphenyl)methylsulfanyl]-3H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 15037656 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-[(3,5-dimethoxyphenyl)methylsulfanyl]-3H-imidazo[4,5-c]pyridine |
| SMILES | COc1cc(CSc2nc3ccncc3[nH]2)cc(OC)c1 |
| InChI | InChI=1S/C15H15N3O2S/c1-19-11-5-10(6-12(7-11)20-2)9-21-15-17-13-3-4-16-8-14(13)18-15/h3-8H,9H2,1-2H3,(H,17,18) |
| InChIKey | ZNAGZDVFIFXPCO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |