C19H14N4O4S — CID 139812498
methyl 2-[(8-nitroquinolin-2-yl)methylsulfanyl]-3H-benzimidazole-5-carboxylate (PubChem CID 139812498) has the molecular formula C19H14N4O4S and a molecular weight of 394.41 g/mol. Its IUPAC name is methyl 2-[(8-nitroquinolin-2-yl)methylsulfanyl]-3H-benzimidazole-5-carboxylate.
| Compound Name | methyl 2-[(8-nitroquinolin-2-yl)methylsulfanyl]-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 139812498 |
| Molecular Formula | C19H14N4O4S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | methyl 2-[(8-nitroquinolin-2-yl)methylsulfanyl]-3H-benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2nc(SCc3ccc4cccc([N+](=O)[O-])c4n3)[nH]c2c1 |
| InChI | InChI=1S/C19H14N4O4S/c1-27-18(24)12-6-8-14-15(9-12)22-19(21-14)28-10-13-7-5-11-3-2-4-16(23(25)26)17(11)20-13/h2-9H,10H2,1H3,(H,21,22) |
| InChIKey | KVLWXGXQNKRKPS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|