C18H13N3O2S — CID 126394786
2-(naphthalen-1-ylmethylsulfanyl)-6-nitro-1H-benzimidazole (PubChem CID 126394786) has the molecular formula C18H13N3O2S and a molecular weight of 335.39 g/mol. Its IUPAC name is 2-(naphthalen-1-ylmethylsulfanyl)-6-nitro-1H-benzimidazole.
| Compound Name | 2-(naphthalen-1-ylmethylsulfanyl)-6-nitro-1H-benzimidazole |
|---|---|
| PubChem CID | 126394786 |
| Molecular Formula | C18H13N3O2S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-(naphthalen-1-ylmethylsulfanyl)-6-nitro-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1ccc2nc(SCc3cccc4ccccc34)[nH]c2c1 |
| InChI | InChI=1S/C18H13N3O2S/c22-21(23)14-8-9-16-17(10-14)20-18(19-16)24-11-13-6-3-5-12-4-1-2-7-15(12)13/h1-10H,11H2,(H,19,20) |
| InChIKey | CDDNQWIIFHVMHF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|