C29H25N5O4S — CID 139971985
2-(1H-imidazol-2-yl)-5-[(6-nitro-1H-benzimidazol-2-yl)sulfanylmethyl]-2-[(1S)-1-phenylethoxy]-3,4-dihydronaphthalen-1-one (PubChem CID 139971985) has the molecular formula C29H25N5O4S and a molecular weight of 539.62 g/mol. Its IUPAC name is 2-(1H-imidazol-2-yl)-5-[(6-nitro-1H-benzimidazol-2-yl)sulfanylmethyl]-2-[(1S)-1-phenylethoxy]-3,4-dihydronaphthalen-1-one.
| Compound Name | 2-(1H-imidazol-2-yl)-5-[(6-nitro-1H-benzimidazol-2-yl)sulfanylmethyl]-2-[(1S)-1-phenylethoxy]-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 139971985 |
| Molecular Formula | C29H25N5O4S |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 2-(1H-imidazol-2-yl)-5-[(6-nitro-1H-benzimidazol-2-yl)sulfanylmethyl]-2-[(1S)-1-phenylethoxy]-3,4-dihydronaphthalen-1-one |
| SMILES | C[C@H](OC1(c2ncc[nH]2)CCc2c(CSc3nc4ccc([N+](=O)[O-])cc4[nH]3)cccc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C29H25N5O4S/c1-18(19-6-3-2-4-7-19)38-29(27-30-14-15-31-27)13-12-22-20(8-5-9-23(22)26(29)35)17-39-28-32-24-11-10-21(34(36)37)16-25(24)33-28/h2-11,14-16,18H,12-13,17H2,1H3,(H,30,31)(H,32,33)/t18-,29?/m0/s1 |
| InChIKey | JYDQBKGYZYRXSD-STFFIMJZSA-N |
| XLogP | 6.29 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|