C16H10N4O3 — CID 98000084
(2R)-2-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-2-phenylacetonitrile (PubChem CID 98000084) has the molecular formula C16H10N4O3 and a molecular weight of 306.28 g/mol. Its IUPAC name is (2R)-2-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-2-phenylacetonitrile.
| Compound Name | (2R)-2-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-2-phenylacetonitrile |
|---|---|
| PubChem CID | 98000084 |
| Molecular Formula | C16H10N4O3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | (2R)-2-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-2-phenylacetonitrile |
| SMILES | N#C[C@H](c1ccccc1)c1nc2ccc([N+](=O)[O-])cc2[nH]c1=O |
| InChI | InChI=1S/C16H10N4O3/c17-9-12(10-4-2-1-3-5-10)15-16(21)19-14-8-11(20(22)23)6-7-13(14)18-15/h1-8,12H,(H,19,21)/t12-/m1/s1 |
| InChIKey | HTNRLIBJOFXXPT-GFCCVEGCSA-N |
| XLogP | 2.49 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|