C19H13N5O9 — CID 92525477
methyl (2S)-4-(4-nitroanilino)-2-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-3,4-dioxobutanoate (PubChem CID 92525477) has the molecular formula C19H13N5O9 and a molecular weight of 455.34 g/mol. Its IUPAC name is methyl (2S)-4-(4-nitroanilino)-2-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-3,4-dioxobutanoate.
| Compound Name | methyl (2S)-4-(4-nitroanilino)-2-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-3,4-dioxobutanoate |
|---|---|
| PubChem CID | 92525477 |
| Molecular Formula | C19H13N5O9 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | methyl (2S)-4-(4-nitroanilino)-2-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-3,4-dioxobutanoate |
| SMILES | COC(=O)[C@H](C(=O)C(=O)Nc1ccc([N+](=O)[O-])cc1)c1nc2ccc([N+](=O)[O-])cc2[nH]c1=O |
| InChI | InChI=1S/C19H13N5O9/c1-33-19(28)14(16(25)18(27)20-9-2-4-10(5-3-9)23(29)30)15-17(26)22-13-8-11(24(31)32)6-7-12(13)21-15/h2-8,14H,1H3,(H,20,27)(H,22,26)/t14-/m0/s1 |
| InChIKey | DLTZSFGVXZRAMZ-AWEZNQCLSA-N |
| XLogP | 1.20 |
| TPSA | 204.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|