C19H14Cl2N6O6 — CID 98557384
methyl (2R,3Z)-4-(2,5-dichloroanilino)-3-hydrazinylidene-2-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-4-oxobutanoate (PubChem CID 98557384) has the molecular formula C19H14Cl2N6O6 and a molecular weight of 493.26 g/mol. Its IUPAC name is methyl (2R,3Z)-4-(2,5-dichloroanilino)-3-hydrazinylidene-2-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-4-oxobutanoate.
| Compound Name | methyl (2R,3Z)-4-(2,5-dichloroanilino)-3-hydrazinylidene-2-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 98557384 |
| Molecular Formula | C19H14Cl2N6O6 |
| Molecular Weight | 493.26 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | methyl (2R,3Z)-4-(2,5-dichloroanilino)-3-hydrazinylidene-2-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-4-oxobutanoate |
| SMILES | COC(=O)[C@@H](/C(=N/N)C(=O)Nc1cc(Cl)ccc1Cl)c1nc2ccc([N+](=O)[O-])cc2[nH]c1=O |
| InChI | InChI=1S/C19H14Cl2N6O6/c1-33-19(30)14(16(26-22)18(29)24-12-6-8(20)2-4-10(12)21)15-17(28)25-13-7-9(27(31)32)3-5-11(13)23-15/h2-7,14H,22H2,1H3,(H,24,29)(H,25,28)/b26-16-/t14-/m1/s1 |
| InChIKey | VRDYVBUXWBMQOP-SQMWUOCYSA-N |
| XLogP | 2.35 |
| TPSA | 182.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|