C20H13Cl3N4O8 — CID 21142089
N-hydroxy-2-[1-methoxy-1,2,4,5-tetraoxo-5-(2,4,5-trichloroanilino)pentan-3-yl]-3-oxo-4H-quinoxalin-6-amine oxide (PubChem CID 21142089) has the molecular formula C20H13Cl3N4O8 and a molecular weight of 543.70 g/mol. Its IUPAC name is N-hydroxy-2-[1-methoxy-1,2,4,5-tetraoxo-5-(2,4,5-trichloroanilino)pentan-3-yl]-3-oxo-4H-quinoxalin-6-amine oxide.
| Compound Name | N-hydroxy-2-[1-methoxy-1,2,4,5-tetraoxo-5-(2,4,5-trichloroanilino)pentan-3-yl]-3-oxo-4H-quinoxalin-6-amine oxide |
|---|---|
| PubChem CID | 21142089 |
| Molecular Formula | C20H13Cl3N4O8 |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 541.98 |
| IUPAC Name | N-hydroxy-2-[1-methoxy-1,2,4,5-tetraoxo-5-(2,4,5-trichloroanilino)pentan-3-yl]-3-oxo-4H-quinoxalin-6-amine oxide |
| SMILES | COC(=O)C(=O)C(C(=O)C(=O)Nc1cc(Cl)c(Cl)cc1Cl)c1nc2ccc([NH+]([O-])O)cc2[nH]c1=O |
| InChI | InChI=1S/C20H13Cl3N4O8/c1-35-20(32)17(29)14(16(28)19(31)25-12-6-9(22)8(21)5-10(12)23)15-18(30)26-13-4-7(27(33)34)2-3-11(13)24-15/h2-6,14,27,33H,1H3,(H,25,31)(H,26,30) |
| InChIKey | VRAQYNVNGOSVCX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 183.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|