C27H15Cl2N3O7 — CID 124632086
methyl (2R)-4-(2,4-dichloroanilino)-3,4-dioxo-2-(2,7,12-trioxo-1H-naphtho[2,3-f]quinoxalin-3-yl)butanoate (PubChem CID 124632086) has the molecular formula C27H15Cl2N3O7 and a molecular weight of 564.34 g/mol. Its IUPAC name is methyl (2R)-4-(2,4-dichloroanilino)-3,4-dioxo-2-(2,7,12-trioxo-1H-naphtho[2,3-f]quinoxalin-3-yl)butanoate.
| Compound Name | methyl (2R)-4-(2,4-dichloroanilino)-3,4-dioxo-2-(2,7,12-trioxo-1H-naphtho[2,3-f]quinoxalin-3-yl)butanoate |
|---|---|
| PubChem CID | 124632086 |
| Molecular Formula | C27H15Cl2N3O7 |
| Molecular Weight | 564.34 g/mol |
| Exact Mass | 563.03 |
| IUPAC Name | methyl (2R)-4-(2,4-dichloroanilino)-3,4-dioxo-2-(2,7,12-trioxo-1H-naphtho[2,3-f]quinoxalin-3-yl)butanoate |
| SMILES | COC(=O)[C@@H](C(=O)C(=O)Nc1ccc(Cl)cc1Cl)c1nc2ccc3c(c2[nH]c1=O)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C27H15Cl2N3O7/c1-39-27(38)19(24(35)26(37)31-16-8-6-11(28)10-15(16)29)21-25(36)32-20-17(30-21)9-7-14-18(20)23(34)13-5-3-2-4-12(13)22(14)33/h2-10,19H,1H3,(H,31,37)(H,32,36)/t19-/m1/s1 |
| InChIKey | UZQWUGZYDSNYIT-LJQANCHMSA-N |
| XLogP | 3.47 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|